C16H23N — CID 67877316
4-prop-2-enyl-2,3,4a,5,6,6a,7,8-octahydro-1H-benzo[f]quinoline (PubChem CID 67877316) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 4-prop-2-enyl-2,3,4a,5,6,6a,7,8-octahydro-1H-benzo[f]quinoline.
| Compound Name | 4-prop-2-enyl-2,3,4a,5,6,6a,7,8-octahydro-1H-benzo[f]quinoline |
|---|---|
| PubChem CID | 67877316 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4-prop-2-enyl-2,3,4a,5,6,6a,7,8-octahydro-1H-benzo[f]quinoline |
| SMILES | C=CCN1CCCC2=C3C=CCCC3CCC21 |
| InChI | InChI=1S/C16H23N/c1-2-11-17-12-5-8-15-14-7-4-3-6-13(14)9-10-16(15)17/h2,4,7,13,16H,1,3,5-6,8-12H2 |
| InChIKey | RIEFDAKIMLJVSU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|