C48H66O4 — CID 67877450
bis[[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl] benzene-1,2-dicarboxylate (PubChem CID 67877450) has the molecular formula C48H66O4 and a molecular weight of 707.05 g/mol. Its IUPAC name is bis[[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67877450 |
| Molecular Formula | C48H66O4 |
| Molecular Weight | 707.05 g/mol |
| Exact Mass | 706.50 |
| IUPAC Name | bis[[(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl] benzene-1,2-dicarboxylate |
| SMILES | CC(C)C1=CC2=CC[C@H]3[C@](C)(COC(=O)c4ccccc4C(=O)OC[C@]4(C)CCC[C@]5(C)[C@H]6CCC(C(C)C)=CC6=CC[C@@H]45)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C48H66O4/c1-31(2)33-15-19-39-35(27-33)17-21-41-45(5,23-11-25-47(39,41)7)29-51-43(49)37-13-9-10-14-38(37)44(50)52-30-46(6)24-12-26-48(8)40-20-16-34(32(3)4)28-36(40)18-22-42(46)48/h9-10,13-14,17-18,27-28,31-32,39-42H,11-12,15-16,19-26,29-30H2,1-8H3/t39-,40-,41-,42-,45-,46-,47+,48+/m0/s1 |
| InChIKey | PGDHVXQUUDBRFD-PXRJHXIUSA-N |
| XLogP | 12.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.05 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |