C13H16N2 — CID 67877650
2-methyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinoline (PubChem CID 67877650) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-methyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinoline.
| Compound Name | 2-methyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinoline |
|---|---|
| PubChem CID | 67877650 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-methyl-2,3,4,7,8,9-hexahydropyrido[2,3-g]quinoline |
| SMILES | CC1CCc2cc3c(cc2=N1)CCCN=3 |
| InChI | InChI=1S/C13H16N2/c1-9-4-5-11-7-12-10(3-2-6-14-12)8-13(11)15-9/h7-9H,2-6H2,1H3 |
| InChIKey | SWTYGDJAGHRINV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|