C34H44N2O4 — CID 67877711
2,2-diethyl-4-[3-[2-[6-[5-(4-hydroxy-3,5-dimethylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid (PubChem CID 67877711) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[5-(4-hydroxy-3,5-dimethylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[5-(4-hydroxy-3,5-dimethylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 67877711 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[5-(4-hydroxy-3,5-dimethylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2cccc(OCCCCCc3cc(C)c(O)c(C)c3)n2)c1)C(=O)O |
| InChI | InChI=1S/C34H44N2O4/c1-5-34(6-2,33(38)39)19-20-35-30-15-10-13-27(24-30)17-18-29-14-11-16-31(36-29)40-21-9-7-8-12-28-22-25(3)32(37)26(4)23-28/h10-11,13-18,22-24,35,37H,5-9,12,19-21H2,1-4H3,(H,38,39) |
| InChIKey | KEEZUEHGWZIFMH-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|