C32H39FN2O3 — CID 67877797
2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid (PubChem CID 67877797) has the molecular formula C32H39FN2O3 and a molecular weight of 518.67 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 67877797 |
| Molecular Formula | C32H39FN2O3 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2cccc(COCCCCc3ccc(F)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C32H39FN2O3/c1-3-32(4-2,31(36)37)20-21-34-29-12-7-10-26(23-29)16-19-28-11-8-13-30(35-28)24-38-22-6-5-9-25-14-17-27(33)18-15-25/h7-8,10-19,23,34H,3-6,9,20-22,24H2,1-2H3,(H,36,37) |
| InChIKey | IEEAXCTZORBZNP-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|