C33H42N2O4 — CID 67877821
2,2-diethyl-4-[3-[2-[6-[4-(4-hydroxy-3-methylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid (PubChem CID 67877821) has the molecular formula C33H42N2O4 and a molecular weight of 530.71 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-(4-hydroxy-3-methylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-hydroxy-3-methylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 67877821 |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-hydroxy-3-methylphenyl)pentoxy]-2-pyridinyl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2cccc(OCCCC(C)c3ccc(O)c(C)c3)n2)c1)C(=O)O |
| InChI | InChI=1S/C33H42N2O4/c1-5-33(6-2,32(37)38)19-20-34-29-13-7-11-26(23-29)15-17-28-12-8-14-31(35-28)39-21-9-10-24(3)27-16-18-30(36)25(4)22-27/h7-8,11-18,22-24,34,36H,5-6,9-10,19-21H2,1-4H3,(H,37,38) |
| InChIKey | CMIJERGMPMQSST-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|