C36H46N2O3 — CID 67877844
4-[3-[2-[6-[4-(4-cyclobutylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid (PubChem CID 67877844) has the molecular formula C36H46N2O3 and a molecular weight of 554.78 g/mol. Its IUPAC name is 4-[3-[2-[6-[4-(4-cyclobutylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid.
| Compound Name | 4-[3-[2-[6-[4-(4-cyclobutylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid |
|---|---|
| PubChem CID | 67877844 |
| Molecular Formula | C36H46N2O3 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | 4-[3-[2-[6-[4-(4-cyclobutylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethylbutanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2cccc(COCCCCc3ccc(C4CCC4)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C36H46N2O3/c1-3-36(4-2,35(39)40)23-24-37-33-15-7-11-29(26-33)19-22-32-14-9-16-34(38-32)27-41-25-6-5-10-28-17-20-31(21-18-28)30-12-8-13-30/h7,9,11,14-22,26,30,37H,3-6,8,10,12-13,23-25,27H2,1-2H3,(H,39,40) |
| InChIKey | KZXYVYUEPSNTGL-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|