About 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid
6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid (PubChem CID 67878612) has the molecular formula C18H23ClN4O4
and a molecular weight of 394.86 g/mol. Its IUPAC name is 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid.
Molecular Properties
| Compound Name | 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid |
| PubChem CID | 67878612 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid |
| SMILES | Cc1c(N2CCNCC2)c(N)cc2c(=O)cc(C(=O)O)n(C3CC3)c12.OCl |
| InChI | InChI=1S/C18H22N4O3.ClHO/c1-10-16-12(8-13(19)17(10)21-6-4-20-5-7-21)15(23)9-14(18(24)25)22(16)11-2-3-11;1-2/h8-9,11,20H,2-7,19H2,1H3,(H,24,25);2H |
| InChIKey | NJRNFRLOFXYTKC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid?
The IUPAC name of 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid (CID 67878612) is 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid.
What is the SMILES notation for 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid?
The canonical SMILES for 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid is Cc1c(N2CCNCC2)c(N)cc2c(=O)cc(C(=O)O)n(C3CC3)c12.OCl.
What is the InChIKey of 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid?
The InChIKey is NJRNFRLOFXYTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O3.ClHO/c1-10-16-12(8-13(19)17(10)21-6-4-20-5-7-21)15(23)9-14(18(24)25)22(16)11-2-3-11;1-2/h8-9,11,20H,2-7,19H2,1H3,(H,24,25);2H.
What are the key properties of 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid?
6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid has a molecular weight of 394.86 g/mol, XLogP of 1.47, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-cyclopropyl-8-methyl-4-oxo-7-piperazin-1-ylquinoline-2-carboxylic acid;hypochlorous acid is sourced from PubChem (CID 67878612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).