About ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate
ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate (PubChem CID 67878615) has the molecular formula C15H14Cl2N2O5
and a molecular weight of 373.19 g/mol. Its IUPAC name is ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate |
| PubChem CID | 67878615 |
| Molecular Formula | C15H14Cl2N2O5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate |
| SMILES | CCOC(=O)C=CNC1CC1C(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O5/c1-2-24-14(20)3-4-18-12-5-9(12)15(21)8-6-13(19(22)23)11(17)7-10(8)16/h3-4,6-7,9,12,18H,2,5H2,1H3 |
| InChIKey | VNGFYERELDITDM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate?
The IUPAC name of ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate (CID 67878615) is ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate.
What is the SMILES notation for ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate?
The canonical SMILES for ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate is CCOC(=O)C=CNC1CC1C(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl.
What is the InChIKey of ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate?
The InChIKey is VNGFYERELDITDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N2O5/c1-2-24-14(20)3-4-18-12-5-9(12)15(21)8-6-13(19(22)23)11(17)7-10(8)16/h3-4,6-7,9,12,18H,2,5H2,1H3.
What are the key properties of ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate?
ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate has a molecular weight of 373.19 g/mol, XLogP of 3.14, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino]prop-2-enoate is sourced from PubChem (CID 67878615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).