C15H25NO6 — CID 67878686
tert-butyl [(2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,6-dihydro-2H-pyran-2-yl] carbonate (PubChem CID 67878686) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl [(2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,6-dihydro-2H-pyran-2-yl] carbonate.
| Compound Name | tert-butyl [(2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,6-dihydro-2H-pyran-2-yl] carbonate |
|---|---|
| PubChem CID | 67878686 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | tert-butyl [(2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,6-dihydro-2H-pyran-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=CCO[C@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO6/c1-14(2,3)21-12(17)16-10-8-7-9-19-11(10)20-13(18)22-15(4,5)6/h7-8,10-11H,9H2,1-6H3,(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | IBCPGLDGXXCPBF-MNOVXSKESA-N |
| XLogP | 2.74 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|