C14H14N2O8S2 — CID 67878727
[(6R,7R)-7-amino-3-[(3,4-dihydroxyphenyl)sulfonylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl] hydrogen carbonate (PubChem CID 67878727) has the molecular formula C14H14N2O8S2 and a molecular weight of 402.41 g/mol. Its IUPAC name is [(6R,7R)-7-amino-3-[(3,4-dihydroxyphenyl)sulfonylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl] hydrogen carbonate.
| Compound Name | [(6R,7R)-7-amino-3-[(3,4-dihydroxyphenyl)sulfonylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67878727 |
| Molecular Formula | C14H14N2O8S2 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | [(6R,7R)-7-amino-3-[(3,4-dihydroxyphenyl)sulfonylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-yl] hydrogen carbonate |
| SMILES | N[C@@H]1C(=O)N2C(OC(=O)O)=C(CS(=O)(=O)c3ccc(O)c(O)c3)CS[C@H]12 |
| InChI | InChI=1S/C14H14N2O8S2/c15-10-11(19)16-12(24-14(20)21)6(4-25-13(10)16)5-26(22,23)7-1-2-8(17)9(18)3-7/h1-3,10,13,17-18H,4-5,15H2,(H,20,21)/t10-,13-/m1/s1 |
| InChIKey | LRKDIMGHBUADNL-ZWNOBZJWSA-N |
| XLogP | 0.02 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|