C17H28N2 — CID 67878833
1,2,2,3-tetrakis(prop-2-enyl)piperidin-4-amine (PubChem CID 67878833) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1,2,2,3-tetrakis(prop-2-enyl)piperidin-4-amine.
| Compound Name | 1,2,2,3-tetrakis(prop-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 67878833 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1,2,2,3-tetrakis(prop-2-enyl)piperidin-4-amine |
| SMILES | C=CCC1C(N)CCN(CC=C)C1(CC=C)CC=C |
| InChI | InChI=1S/C17H28N2/c1-5-9-15-16(18)10-14-19(13-8-4)17(15,11-6-2)12-7-3/h5-8,15-16H,1-4,9-14,18H2 |
| InChIKey | QXWGXXFDNWLSNA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|