C38H34N2O4S — CID 67879550
prop-2-enyl (2S,4S)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 67879550) has the molecular formula C38H34N2O4S and a molecular weight of 614.77 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67879550 |
| Molecular Formula | C38H34N2O4S |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-enyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1C=CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C38H34N2O4S/c1-2-25-44-37(43)40-27-32(26-31(40)21-14-24-39-35(41)33-22-12-13-23-34(33)36(39)42)45-38(28-15-6-3-7-16-28,29-17-8-4-9-18-29)30-19-10-5-11-20-30/h2-23,31-32H,1,24-27H2/t31-,32+/m1/s1 |
| InChIKey | MOKLUDZKTVRICT-ZWXJPIIXSA-N |
| XLogP | 7.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|