About didecyl benzene-1,2-dicarboxylate
didecyl benzene-1,2-dicarboxylate (PubChem CID 6788) has the molecular formula C28H46O4
and a molecular weight of 446.67 g/mol. Its IUPAC name is didecyl benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | didecyl benzene-1,2-dicarboxylate |
| PubChem CID | 6788 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | didecyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3 |
| InChIKey | PGIBJVOPLXHHGS-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze didecyl benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl benzene-1,2-dicarboxylate?
The IUPAC name of didecyl benzene-1,2-dicarboxylate (CID 6788) is didecyl benzene-1,2-dicarboxylate.
What is the SMILES notation for didecyl benzene-1,2-dicarboxylate?
The canonical SMILES for didecyl benzene-1,2-dicarboxylate is CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC.
What is the InChIKey of didecyl benzene-1,2-dicarboxylate?
The InChIKey is PGIBJVOPLXHHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3.
What are the key properties of didecyl benzene-1,2-dicarboxylate?
didecyl benzene-1,2-dicarboxylate has a molecular weight of 446.67 g/mol, XLogP of 8.28, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl benzene-1,2-dicarboxylate is sourced from PubChem (CID 6788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).