C12H14F3NO5 — CID 67880222
but-2-enedioic acid;2,2,2-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanone (PubChem CID 67880222) has the molecular formula C12H14F3NO5 and a molecular weight of 309.24 g/mol. Its IUPAC name is but-2-enedioic acid;2,2,2-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanone.
| Compound Name | but-2-enedioic acid;2,2,2-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 67880222 |
| Molecular Formula | C12H14F3NO5 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | but-2-enedioic acid;2,2,2-trifluoro-1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanone |
| SMILES | CN1CCC=C(C(=O)C(F)(F)F)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C8H10F3NO.C4H4O4/c1-12-4-2-3-6(5-12)7(13)8(9,10)11;5-3(6)1-2-4(7)8/h3H,2,4-5H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FIKGCOIPFOCOFZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|