About but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one
but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one (PubChem CID 67880251) has the molecular formula C15H21NO5
and a molecular weight of 295.33 g/mol. Its IUPAC name is but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one.
Molecular Properties
| Compound Name | but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one |
| PubChem CID | 67880251 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one |
| SMILES | C=CCC(=O)C1=CCN(CC)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H17NO.C4H4O4/c1-3-5-11(13)10-6-8-12(4-2)9-7-10;5-3(6)1-2-4(7)8/h3,6H,1,4-5,7-9H2,2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | AXDTTWAUVSXGNZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one?
The IUPAC name of but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one (CID 67880251) is but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one.
What is the SMILES notation for but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one?
The canonical SMILES for but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one is C=CCC(=O)C1=CCN(CC)CC1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one?
The InChIKey is AXDTTWAUVSXGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO.C4H4O4/c1-3-5-11(13)10-6-8-12(4-2)9-7-10;5-3(6)1-2-4(7)8/h3,6H,1,4-5,7-9H2,2H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one?
but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one has a molecular weight of 295.33 g/mol, XLogP of 1.50, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;1-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)but-3-en-1-one is sourced from PubChem (CID 67880251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).