C23H38N4O6S2 — CID 67881415
(8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3,4-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 67881415) has the molecular formula C23H38N4O6S2 and a molecular weight of 530.71 g/mol. Its IUPAC name is (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3,4-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3,4-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 67881415 |
| Molecular Formula | C23H38N4O6S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (8aS,12aR,13aS)-12-[3-(dimethylsulfamoylamino)propylsulfonyl]-3,4-dimethoxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | COc1ccc2c(c1OC)CCN1C[C@@H]3CCCN(S(=O)(=O)CCCNS(=O)(=O)N(C)C)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C23H38N4O6S2/c1-25(2)35(30,31)24-11-6-14-34(28,29)27-12-5-7-17-16-26-13-10-19-18(21(26)15-20(17)27)8-9-22(32-3)23(19)33-4/h8-9,17,20-21,24H,5-7,10-16H2,1-4H3/t17-,20+,21-/m0/s1 |
| InChIKey | BOPDXMKXGKWULC-WMQCIHAUSA-N |
| XLogP | 1.20 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|