C22H31ClN2O4S — CID 67881423
(1S,15S,20R)-19-(4-chloro-3-methylbutan-2-yl)sulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene (PubChem CID 67881423) has the molecular formula C22H31ClN2O4S and a molecular weight of 455.02 g/mol. Its IUPAC name is (1S,15S,20R)-19-(4-chloro-3-methylbutan-2-yl)sulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene.
| Compound Name | (1S,15S,20R)-19-(4-chloro-3-methylbutan-2-yl)sulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene |
|---|---|
| PubChem CID | 67881423 |
| Molecular Formula | C22H31ClN2O4S |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (1S,15S,20R)-19-(4-chloro-3-methylbutan-2-yl)sulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene |
| SMILES | CC(CCl)C(C)S(=O)(=O)N1CCC[C@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@H]21)OCO5 |
| InChI | InChI=1S/C22H31ClN2O4S/c1-14(11-23)15(2)30(26,27)25-6-3-4-17-12-24-7-5-16-8-21-22(29-13-28-21)9-18(16)20(24)10-19(17)25/h8-9,14-15,17,19-20H,3-7,10-13H2,1-2H3/t14?,15?,17-,19+,20-/m0/s1 |
| InChIKey | DRENIHTXBCKVIJ-NERXFSSISA-N |
| XLogP | 3.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|