C22H33N3O6S2 — CID 67881620
N-[4-[[(1S,15R,20S)-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl]sulfonyl]butyl]methanesulfonamide (PubChem CID 67881620) has the molecular formula C22H33N3O6S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[4-[[(1S,15R,20S)-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl]sulfonyl]butyl]methanesulfonamide.
| Compound Name | N-[4-[[(1S,15R,20S)-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl]sulfonyl]butyl]methanesulfonamide |
|---|---|
| PubChem CID | 67881620 |
| Molecular Formula | C22H33N3O6S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[4-[[(1S,15R,20S)-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-19-yl]sulfonyl]butyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCCS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(cc4[C@@H]3C[C@@H]21)OCO5 |
| InChI | InChI=1S/C22H33N3O6S2/c1-32(26,27)23-7-2-3-10-33(28,29)25-8-4-5-17-14-24-9-6-16-11-21-22(31-15-30-21)12-18(16)20(24)13-19(17)25/h11-12,17,19-20,23H,2-10,13-15H2,1H3/t17-,19+,20+/m1/s1 |
| InChIKey | GGHQYXNHZNCBIJ-HOJAQTOUSA-N |
| XLogP | 1.46 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|