C20H31N3O5S2 — CID 67881688
N-[3-[[(8aS,12aR,13aS)-3-hydroxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propyl]methanesulfonamide (PubChem CID 67881688) has the molecular formula C20H31N3O5S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[3-[[(8aS,12aR,13aS)-3-hydroxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propyl]methanesulfonamide.
| Compound Name | N-[3-[[(8aS,12aR,13aS)-3-hydroxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 67881688 |
| Molecular Formula | C20H31N3O5S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[3-[[(8aS,12aR,13aS)-3-hydroxy-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-12-yl]sulfonyl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCS(=O)(=O)N1CCC[C@H]2CN3CCc4cc(O)ccc4[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C20H31N3O5S2/c1-29(25,26)21-8-3-11-30(27,28)23-9-2-4-16-14-22-10-7-15-12-17(24)5-6-18(15)20(22)13-19(16)23/h5-6,12,16,19-21,24H,2-4,7-11,13-14H2,1H3/t16-,19+,20-/m0/s1 |
| InChIKey | FGNSCASBHBHDFV-DBVUQKKJSA-N |
| XLogP | 1.04 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|