About benzo[e][1,3]benzoxazole;1,3-benzothiazole
benzo[e][1,3]benzoxazole;1,3-benzothiazole (PubChem CID 67881799) has the molecular formula C18H12N2OS
and a molecular weight of 304.37 g/mol. Its IUPAC name is benzo[e][1,3]benzoxazole;1,3-benzothiazole.
Molecular Properties
| Compound Name | benzo[e][1,3]benzoxazole;1,3-benzothiazole |
| PubChem CID | 67881799 |
| Molecular Formula | C18H12N2OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | benzo[e][1,3]benzoxazole;1,3-benzothiazole |
| SMILES | c1ccc2c(c1)ccc1ocnc12.c1ccc2scnc2c1 |
| InChI | InChI=1S/C11H7NO.C7H5NS/c1-2-4-9-8(3-1)5-6-10-11(9)12-7-13-10;1-2-4-7-6(3-1)8-5-9-7/h1-7H;1-5H |
| InChIKey | GKTHCBWFPMJCHA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzo[e][1,3]benzoxazole;1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1,3]benzoxazole;1,3-benzothiazole?
The IUPAC name of benzo[e][1,3]benzoxazole;1,3-benzothiazole (CID 67881799) is benzo[e][1,3]benzoxazole;1,3-benzothiazole.
What is the SMILES notation for benzo[e][1,3]benzoxazole;1,3-benzothiazole?
The canonical SMILES for benzo[e][1,3]benzoxazole;1,3-benzothiazole is c1ccc2c(c1)ccc1ocnc12.c1ccc2scnc2c1.
What is the InChIKey of benzo[e][1,3]benzoxazole;1,3-benzothiazole?
The InChIKey is GKTHCBWFPMJCHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO.C7H5NS/c1-2-4-9-8(3-1)5-6-10-11(9)12-7-13-10;1-2-4-7-6(3-1)8-5-9-7/h1-7H;1-5H.
What are the key properties of benzo[e][1,3]benzoxazole;1,3-benzothiazole?
benzo[e][1,3]benzoxazole;1,3-benzothiazole has a molecular weight of 304.37 g/mol, XLogP of 5.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1,3]benzoxazole;1,3-benzothiazole is sourced from PubChem (CID 67881799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).