5-(4-hydroxyphenyl)pent-4-enoic acid

C11H12O3 — CID 67881983

IUPAC5-(4-hydroxyphenyl)pent-4-enoic acid
SMILESO=C(O)CCC=Cc1ccc(O)cc1
InChIInChI=1S/C11H12O3/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h1,3,5-8,12H,2,4H2,(H,13,14)
InChIKeyFOLDOLYDRQTQBN-UHFFFAOYSA-N
MW192.21 g/mol
LogP2.27
Rot. Bonds4

About 5-(4-hydroxyphenyl)pent-4-enoic acid

5-(4-hydroxyphenyl)pent-4-enoic acid (PubChem CID 67881983) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)pent-4-enoic acid.

Molecular Properties

Compound Name5-(4-hydroxyphenyl)pent-4-enoic acid
PubChem CID67881983
Molecular FormulaC11H12O3
Molecular Weight192.21 g/mol
Exact Mass192.08
IUPAC Name5-(4-hydroxyphenyl)pent-4-enoic acid
SMILESO=C(O)CCC=Cc1ccc(O)cc1
InChIInChI=1S/C11H12O3/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h1,3,5-8,12H,2,4H2,(H,13,14)
InChIKeyFOLDOLYDRQTQBN-UHFFFAOYSA-N
XLogP2.27
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.21
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-(4-hydroxyphenyl)pent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(Z)-27-(4-hydroxyphenyl)heptacos-26-enoic acid
CID 177424938
(E)-5-phenylpent-4-enoic acid
CID 5370650
5-(3,4-dihydroxyphenyl)pent-4-enoic acid
CID 90882623
5-(4-methoxyphenyl)pent-4-enoic acid
CID 54081465
5-(4-ethoxyphenyl)pent-4-enoic acid
CID 54525695
(E)-5-naphthalen-2-ylpent-4-enoic acid
CID 10263103
4-[(E)-pent-1-enyl]phenol
CID 15576502
(E)-6-(4-bromophenyl)hex-5-enoic acid
CID 14939379
5-(4-fluoro-3-methylphenyl)pent-4-enoic acid
CID 171372503
7-(4-fluorophenyl)hept-6-enoic acid
CID 54475519
3-[4-(4-hydroxybut-1-enyl)phenyl]propanoic acid
CID 170477084
(E)-5-(4-hydroxyphenyl)pent-4-enenitrile
CID 131246029

Frequently Asked Questions

What is the IUPAC name of 5-(4-hydroxyphenyl)pent-4-enoic acid?
The IUPAC name of 5-(4-hydroxyphenyl)pent-4-enoic acid (CID 67881983) is 5-(4-hydroxyphenyl)pent-4-enoic acid.
What is the SMILES notation for 5-(4-hydroxyphenyl)pent-4-enoic acid?
The canonical SMILES for 5-(4-hydroxyphenyl)pent-4-enoic acid is O=C(O)CCC=Cc1ccc(O)cc1.
What is the InChIKey of 5-(4-hydroxyphenyl)pent-4-enoic acid?
The InChIKey is FOLDOLYDRQTQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h1,3,5-8,12H,2,4H2,(H,13,14).
What are the key properties of 5-(4-hydroxyphenyl)pent-4-enoic acid?
5-(4-hydroxyphenyl)pent-4-enoic acid has a molecular weight of 192.21 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxyphenyl)pent-4-enoic acid is sourced from PubChem (CID 67881983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).