About ethyl (2-methylpiperidin-3-yl) carbonate
ethyl (2-methylpiperidin-3-yl) carbonate (PubChem CID 67882012) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethyl (2-methylpiperidin-3-yl) carbonate.
Molecular Properties
| Compound Name | ethyl (2-methylpiperidin-3-yl) carbonate |
| PubChem CID | 67882012 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | ethyl (2-methylpiperidin-3-yl) carbonate |
| SMILES | CCOC(=O)OC1CCCNC1C |
| InChI | InChI=1S/C9H17NO3/c1-3-12-9(11)13-8-5-4-6-10-7(8)2/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | WNTCQLDBGBRHLU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2-methylpiperidin-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-methylpiperidin-3-yl) carbonate?
The IUPAC name of ethyl (2-methylpiperidin-3-yl) carbonate (CID 67882012) is ethyl (2-methylpiperidin-3-yl) carbonate.
What is the SMILES notation for ethyl (2-methylpiperidin-3-yl) carbonate?
The canonical SMILES for ethyl (2-methylpiperidin-3-yl) carbonate is CCOC(=O)OC1CCCNC1C.
What is the InChIKey of ethyl (2-methylpiperidin-3-yl) carbonate?
The InChIKey is WNTCQLDBGBRHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-12-9(11)13-8-5-4-6-10-7(8)2/h7-8,10H,3-6H2,1-2H3.
What are the key properties of ethyl (2-methylpiperidin-3-yl) carbonate?
ethyl (2-methylpiperidin-3-yl) carbonate has a molecular weight of 187.24 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-methylpiperidin-3-yl) carbonate is sourced from PubChem (CID 67882012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).