About azane;1H-pteridin-2-one
azane;1H-pteridin-2-one (PubChem CID 67883083) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is azane;1H-pteridin-2-one.
Molecular Properties
| Compound Name | azane;1H-pteridin-2-one |
| PubChem CID | 67883083 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | azane;1H-pteridin-2-one |
| SMILES | N.O=c1ncc2nccnc2[nH]1 |
| InChI | InChI=1S/C6H4N4O.H3N/c11-6-9-3-4-5(10-6)8-2-1-7-4;/h1-3H,(H,8,9,10,11);1H3 |
| InChIKey | GLEFRQYZHZMYKJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;1H-pteridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1H-pteridin-2-one?
The IUPAC name of azane;1H-pteridin-2-one (CID 67883083) is azane;1H-pteridin-2-one.
What is the SMILES notation for azane;1H-pteridin-2-one?
The canonical SMILES for azane;1H-pteridin-2-one is N.O=c1ncc2nccnc2[nH]1.
What is the InChIKey of azane;1H-pteridin-2-one?
The InChIKey is GLEFRQYZHZMYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O.H3N/c11-6-9-3-4-5(10-6)8-2-1-7-4;/h1-3H,(H,8,9,10,11);1H3.
What are the key properties of azane;1H-pteridin-2-one?
azane;1H-pteridin-2-one has a molecular weight of 165.16 g/mol, XLogP of -0.12, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1H-pteridin-2-one is sourced from PubChem (CID 67883083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).