C20H37N3O2 — CID 67883523
4,4,6-trimethyltetradecan-3-yl 1,2,4-triazole-1-carboxylate (PubChem CID 67883523) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 4,4,6-trimethyltetradecan-3-yl 1,2,4-triazole-1-carboxylate.
| Compound Name | 4,4,6-trimethyltetradecan-3-yl 1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 67883523 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 4,4,6-trimethyltetradecan-3-yl 1,2,4-triazole-1-carboxylate |
| SMILES | CCCCCCCCC(C)CC(C)(C)C(CC)OC(=O)n1cncn1 |
| InChI | InChI=1S/C20H37N3O2/c1-6-8-9-10-11-12-13-17(3)14-20(4,5)18(7-2)25-19(24)23-16-21-15-22-23/h15-18H,6-14H2,1-5H3 |
| InChIKey | KZTUWMPYSYZMKO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|