C29H29N7Na2O4 — CID 67883564
CID 67883564 (PubChem CID 67883564) has the molecular formula C29H29N7Na2O4 and a molecular weight of 585.58 g/mol.
| Compound Name | CID 67883564 |
|---|---|
| PubChem CID | 67883564 |
| Molecular Formula | C29H29N7Na2O4 |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | — |
| SMILES | CCCc1nc2c(n1-c1ccc(-c3ccccc3-c3nn[nH]n3)cc1)C1C(O)=C(C(=O)OCC)C(=O)N1CC2C.[Na].[Na] |
| InChI | InChI=1S/C29H29N7O4.2Na/c1-4-8-21-30-23-16(3)15-35-25(26(37)22(28(35)38)29(39)40-5-2)24(23)36(21)18-13-11-17(12-14-18)19-9-6-7-10-20(19)27-31-33-34-32-27;;/h6-7,9-14,16,25,37H,4-5,8,15H2,1-3H3,(H,31,32,33,34);; |
| InChIKey | JKMBGJFWNJHTLP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|