C26H40ClNO7 — CID 67883657
[(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-morpholin-4-ylacetate;hydrochloride (PubChem CID 67883657) has the molecular formula C26H40ClNO7 and a molecular weight of 514.06 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-morpholin-4-ylacetate;hydrochloride.
| Compound Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-morpholin-4-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 67883657 |
| Molecular Formula | C26H40ClNO7 |
| Molecular Weight | 514.06 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 2-morpholin-4-ylacetate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]2(O)[C@](C)(O1)[C@@H](OC(=O)CN1CCOCC1)C=C1C(C)(C)CC[C@H](O)[C@@]12C.Cl |
| InChI | InChI=1S/C26H39NO7.ClH/c1-7-23(4)15-19(29)26(31)24(5)17(22(2,3)9-8-18(24)28)14-20(25(26,6)34-23)33-21(30)16-27-10-12-32-13-11-27;/h7,14,18,20,28,31H,1,8-13,15-16H2,2-6H3;1H/t18-,20-,23-,24+,25+,26-;/m0./s1 |
| InChIKey | PPZPELNRXUDTIZ-AZKDOIACSA-N |
| XLogP | 2.20 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.06 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|