C16H29ClO — CID 67883714
(1R,2S,5S)-2-[2-(5-chloropentoxy)ethyl]-6,6-dimethylbicyclo[3.1.1]heptane (PubChem CID 67883714) has the molecular formula C16H29ClO and a molecular weight of 272.86 g/mol. Its IUPAC name is (1R,2S,5S)-2-[2-(5-chloropentoxy)ethyl]-6,6-dimethylbicyclo[3.1.1]heptane.
| Compound Name | (1R,2S,5S)-2-[2-(5-chloropentoxy)ethyl]-6,6-dimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 67883714 |
| Molecular Formula | C16H29ClO |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (1R,2S,5S)-2-[2-(5-chloropentoxy)ethyl]-6,6-dimethylbicyclo[3.1.1]heptane |
| SMILES | CC1(C)[C@H]2CC[C@@H](CCOCCCCCCl)[C@H]1C2 |
| InChI | InChI=1S/C16H29ClO/c1-16(2)14-7-6-13(15(16)12-14)8-11-18-10-5-3-4-9-17/h13-15H,3-12H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | VWRBPCHVTBUUAH-SOUVJXGZSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|