C19H23NO2 — CID 67883872
2-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-3-(4-methylphenyl)prop-2-enoic acid (PubChem CID 67883872) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-3-(4-methylphenyl)prop-2-enoic acid.
| Compound Name | 2-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-3-(4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67883872 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-3-(4-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(C=C(CN2C[C@H]3CC=CC[C@H]3C2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-14-6-8-15(9-7-14)10-18(19(21)22)13-20-11-16-4-2-3-5-17(16)12-20/h2-3,6-10,16-17H,4-5,11-13H2,1H3,(H,21,22)/t16-,17+ |
| InChIKey | LQPSGJAIYHYMPU-CALCHBBNSA-N |
| XLogP | 3.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|