C18H14BrF3O3 — CID 67883904
[(4R,5R)-4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 67883904) has the molecular formula C18H14BrF3O3 and a molecular weight of 415.21 g/mol. Its IUPAC name is [(4R,5R)-4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4R,5R)-4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 67883904 |
| Molecular Formula | C18H14BrF3O3 |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [(4R,5R)-4-bromo-5-hydroxy-2,3,4,5-tetrahydro-1-benzoxepin-7-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H](O)[C@H](Br)CCO2)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H14BrF3O3/c19-14-7-8-25-15-6-5-10(9-12(15)17(14)24)16(23)11-3-1-2-4-13(11)18(20,21)22/h1-6,9,14,17,24H,7-8H2/t14-,17-/m1/s1 |
| InChIKey | WHJBXBJXJPVMHB-RHSMWYFYSA-N |
| XLogP | 4.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|