C41H23FN8O2 — CID 67884137
7-(4-fluoro-3-nitrophenyl)-2,3,5-tripyridin-2-ylporphyrin (PubChem CID 67884137) has the molecular formula C41H23FN8O2 and a molecular weight of 678.69 g/mol. Its IUPAC name is 7-(4-fluoro-3-nitrophenyl)-2,3,5-tripyridin-2-ylporphyrin.
| Compound Name | 7-(4-fluoro-3-nitrophenyl)-2,3,5-tripyridin-2-ylporphyrin |
|---|---|
| PubChem CID | 67884137 |
| Molecular Formula | C41H23FN8O2 |
| Molecular Weight | 678.69 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 7-(4-fluoro-3-nitrophenyl)-2,3,5-tripyridin-2-ylporphyrin |
| SMILES | O=[N+]([O-])c1cc(C2=C/C3=C/C4=N/C(=C\C5=N/C(=C\C6=N/C(=C(/c7ccccn7)C2=N3)C(c2ccccn2)=C6c2ccccn2)C=C5)C=C4)ccc1F |
| InChI | InChI=1S/C41H23FN8O2/c42-31-15-10-24(19-36(31)50(51)52)30-22-29-21-27-12-11-25(46-27)20-26-13-14-28(47-26)23-35-37(32-7-1-4-16-43-32)38(33-8-2-5-17-44-33)41(49-35)39(40(30)48-29)34-9-3-6-18-45-34/h1-23H/b25-20-,26-20-,27-21-,28-23-,29-21-,35-23-,40-39-,41-39- |
| InChIKey | XDHCVOLBYDKPGY-WEKMOZHTSA-N |
| XLogP | 7.92 |
| TPSA | 131.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.69 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|