C18H24O3Zn — CID 67884276
4-oxo-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)butanoic acid;zinc (PubChem CID 67884276) has the molecular formula C18H24O3Zn and a molecular weight of 353.78 g/mol. Its IUPAC name is 4-oxo-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)butanoic acid;zinc.
| Compound Name | 4-oxo-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)butanoic acid;zinc |
|---|---|
| PubChem CID | 67884276 |
| Molecular Formula | C18H24O3Zn |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-oxo-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)butanoic acid;zinc |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)CCC(=O)O)ccc21.[Zn] |
| InChI | InChI=1S/C18H24O3.Zn/c1-17(2)9-10-18(3,4)14-11-12(5-6-13(14)17)15(19)7-8-16(20)21;/h5-6,11H,7-10H2,1-4H3,(H,20,21); |
| InChIKey | ZSDUGIQOXMELAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|