C19H35NO6Si — CID 67885265
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxy-2,3-dioxopropyl)pyrrolidine-1-carboxylate (PubChem CID 67885265) has the molecular formula C19H35NO6Si and a molecular weight of 401.58 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxy-2,3-dioxopropyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxy-2,3-dioxopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67885265 |
| Molecular Formula | C19H35NO6Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxy-2,3-dioxopropyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C(=O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35NO6Si/c1-18(2,3)25-17(23)20-12-14(26-27(8,9)19(4,5)6)10-13(20)11-15(21)16(22)24-7/h13-14H,10-12H2,1-9H3/t13-,14+/m0/s1 |
| InChIKey | UDKJVOXGHRHMOU-UONOGXRCSA-N |
| XLogP | 3.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|