C40H42N6O4 — CID 67885657
bis[9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-1,2,3,4-tetrahydrocarbazol-1-yl] (Z)-but-2-enedioate (PubChem CID 67885657) has the molecular formula C40H42N6O4 and a molecular weight of 670.81 g/mol. Its IUPAC name is bis[9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-1,2,3,4-tetrahydrocarbazol-1-yl] (Z)-but-2-enedioate.
| Compound Name | bis[9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-1,2,3,4-tetrahydrocarbazol-1-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67885657 |
| Molecular Formula | C40H42N6O4 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | bis[9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-1,2,3,4-tetrahydrocarbazol-1-yl] (Z)-but-2-enedioate |
| SMILES | Cc1[nH]cnc1CC1Cc2c(n(C)c3ccccc23)C(OC(=O)/C=C\C(=O)OC2CC(Cc3nc[nH]c3C)Cc3c2n(C)c2ccccc32)C1 |
| InChI | InChI=1S/C40H42N6O4/c1-23-31(43-21-41-23)17-25-15-29-27-9-5-7-11-33(27)45(3)39(29)35(19-25)49-37(47)13-14-38(48)50-36-20-26(18-32-24(2)42-22-44-32)16-30-28-10-6-8-12-34(28)46(4)40(30)36/h5-14,21-22,25-26,35-36H,15-20H2,1-4H3,(H,41,43)(H,42,44)/b14-13- |
| InChIKey | ZKEFXAHYBNRIHA-YPKPFQOOSA-N |
| XLogP | 6.77 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|