C40H36F2N6O6 — CID 67885862
bis[7-fluoro-9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate (PubChem CID 67885862) has the molecular formula C40H36F2N6O6 and a molecular weight of 734.76 g/mol. Its IUPAC name is bis[7-fluoro-9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate.
| Compound Name | bis[7-fluoro-9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67885862 |
| Molecular Formula | C40H36F2N6O6 |
| Molecular Weight | 734.76 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | bis[7-fluoro-9-methyl-3-[(5-methyl-1H-imidazol-4-yl)methyl]-4-oxo-2,3-dihydro-1H-carbazol-1-yl] (Z)-but-2-enedioate |
| SMILES | Cc1[nH]cnc1CC1CC(OC(=O)/C=C\C(=O)OC2CC(Cc3nc[nH]c3C)C(=O)c3c2n(C)c2cc(F)ccc32)c2c(c3ccc(F)cc3n2C)C1=O |
| InChI | InChI=1S/C40H36F2N6O6/c1-19-27(45-17-43-19)11-21-13-31(37-35(39(21)51)25-7-5-23(41)15-29(25)47(37)3)53-33(49)9-10-34(50)54-32-14-22(12-28-20(2)44-18-46-28)40(52)36-26-8-6-24(42)16-30(26)48(4)38(32)36/h5-10,15-18,21-22,31-32H,11-14H2,1-4H3,(H,43,45)(H,44,46)/b10-9- |
| InChIKey | RNDVCYIEDIXOJQ-KTKRTIGZSA-N |
| XLogP | 6.33 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.76 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|