C24H34N4O9S — CID 67885918
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid (PubChem CID 67885918) has the molecular formula C24H34N4O9S and a molecular weight of 554.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 67885918 |
| Molecular Formula | C24H34N4O9S |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H34N4O9S/c1-38-12-11-15(25)21(33)28-18(13-14-5-3-2-4-6-14)23(35)26-16(7-9-19(29)30)22(34)27-17(24(36)37)8-10-20(31)32/h2-6,15-18H,7-13,25H2,1H3,(H,26,35)(H,27,34)(H,28,33)(H,29,30)(H,31,32)(H,36,37)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | RUUVHMRFYGZGAD-XSLAGTTESA-N |
| XLogP | -0.42 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |