C11H21N3 — CID 67886016
N,N-diamino-4,6-diethyl-6-methylcyclohexa-2,4-dien-1-amine (PubChem CID 67886016) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N,N-diamino-4,6-diethyl-6-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | N,N-diamino-4,6-diethyl-6-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67886016 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N,N-diamino-4,6-diethyl-6-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CCC1=CC(C)(CC)C(N(N)N)C=C1 |
| InChI | InChI=1S/C11H21N3/c1-4-9-6-7-10(14(12)13)11(3,5-2)8-9/h6-8,10H,4-5,12-13H2,1-3H3 |
| InChIKey | YCXQFBYYGNUPGS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|