About 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one
7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one (PubChem CID 67886636) has the molecular formula C17H15FN6O2
and a molecular weight of 354.35 g/mol. Its IUPAC name is 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one |
| PubChem CID | 67886636 |
| Molecular Formula | C17H15FN6O2 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2cc(F)ccc2n2cnc(-n3cc(C4CCOC4)nn3)c12 |
| InChI | InChI=1S/C17H15FN6O2/c1-22-16-15(24-7-13(20-21-24)10-4-5-26-8-10)19-9-23(16)14-3-2-11(18)6-12(14)17(22)25/h2-3,6-7,9-10H,4-5,8H2,1H3 |
| InChIKey | YXLXNSNWNMLVNY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one?
The IUPAC name of 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one (CID 67886636) is 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one.
What is the SMILES notation for 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one?
The canonical SMILES for 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one is Cn1c(=O)c2cc(F)ccc2n2cnc(-n3cc(C4CCOC4)nn3)c12.
What is the InChIKey of 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one?
The InChIKey is YXLXNSNWNMLVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN6O2/c1-22-16-15(24-7-13(20-21-24)10-4-5-26-8-10)19-9-23(16)14-3-2-11(18)6-12(14)17(22)25/h2-3,6-7,9-10H,4-5,8H2,1H3.
What are the key properties of 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one?
7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one has a molecular weight of 354.35 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methyl-3-[4-(oxolan-3-yl)triazol-1-yl]imidazo[1,5-a]quinazolin-5-one is sourced from PubChem (CID 67886636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).