C17H14ClN5O2S — CID 67887433
3-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-5-(thiolan-3-yl)-1,2,4-oxadiazole (PubChem CID 67887433) has the molecular formula C17H14ClN5O2S and a molecular weight of 387.85 g/mol. Its IUPAC name is 3-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-5-(thiolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-5-(thiolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67887433 |
| Molecular Formula | C17H14ClN5O2S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-5-(thiolan-3-yl)-1,2,4-oxadiazole |
| SMILES | Cc1c2c(-c3noc(C4CCSC4)n3)ncn2c2ccc(Cl)cc2[n+]1[O-] |
| InChI | InChI=1S/C17H14ClN5O2S/c1-9-15-14(16-20-17(25-21-16)10-4-5-26-7-10)19-8-22(15)12-3-2-11(18)6-13(12)23(9)24/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | WFOUNLRBPHKLHL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|