About 1-methylpyrrolidin-2-one;1,8-naphthyridine
1-methylpyrrolidin-2-one;1,8-naphthyridine (PubChem CID 67888040) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;1,8-naphthyridine.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;1,8-naphthyridine |
| PubChem CID | 67888040 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-methylpyrrolidin-2-one;1,8-naphthyridine |
| SMILES | CN1CCCC1=O.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C5H9NO/c1-3-7-4-2-6-10-8(7)9-5-1;1-6-4-2-3-5(6)7/h1-6H;2-4H2,1H3 |
| InChIKey | FDADJQUIVPGRNG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpyrrolidin-2-one;1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;1,8-naphthyridine?
The IUPAC name of 1-methylpyrrolidin-2-one;1,8-naphthyridine (CID 67888040) is 1-methylpyrrolidin-2-one;1,8-naphthyridine.
What is the SMILES notation for 1-methylpyrrolidin-2-one;1,8-naphthyridine?
The canonical SMILES for 1-methylpyrrolidin-2-one;1,8-naphthyridine is CN1CCCC1=O.c1cnc2ncccc2c1.
What is the InChIKey of 1-methylpyrrolidin-2-one;1,8-naphthyridine?
The InChIKey is FDADJQUIVPGRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C5H9NO/c1-3-7-4-2-6-10-8(7)9-5-1;1-6-4-2-3-5(6)7/h1-6H;2-4H2,1H3.
What are the key properties of 1-methylpyrrolidin-2-one;1,8-naphthyridine?
1-methylpyrrolidin-2-one;1,8-naphthyridine has a molecular weight of 229.28 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;1,8-naphthyridine is sourced from PubChem (CID 67888040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).