C23H28O13S — CID 67888133
1-(4-acetyloxy-5-methyl-3-methylidene-6-thiophen-2-ylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67888133) has the molecular formula C23H28O13S and a molecular weight of 544.53 g/mol. Its IUPAC name is 1-(4-acetyloxy-5-methyl-3-methylidene-6-thiophen-2-ylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-thiophen-2-ylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67888133 |
| Molecular Formula | C23H28O13S |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 1-(4-acetyloxy-5-methyl-3-methylidene-6-thiophen-2-ylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(O)C2O)C(OC(C)=O)C(C)Cc1cccs1 |
| InChI | InChI=1S/C23H28O13S/c1-10(14(34-12(3)24)11(2)9-13-5-4-8-37-13)6-7-21-15(25)16(26)23(36-21,20(31)32)22(33,19(29)30)17(35-21)18(27)28/h4-5,8,11,14-17,25-26,33H,1,6-7,9H2,2-3H3,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | KBJDKIGDFRHTDG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 217.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|