C9H17NO4 — CID 67888141
(2R,3R,4R,5R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-3,4,5-triol (PubChem CID 67888141) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 67888141 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-3,4,5-triol |
| SMILES | C=CCC1N[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO4/c1-2-3-5-7(12)9(14)8(13)6(4-11)10-5/h2,5-14H,1,3-4H2/t5?,6-,7-,8-,9-/m1/s1 |
| InChIKey | QALUOQSYKHLKDB-KFUBRKPTSA-N |
| XLogP | -2.02 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|