C10H18O4 — CID 67888582
(4aS,7R,7aS)-2,2-diethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol (PubChem CID 67888582) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (4aS,7R,7aS)-2,2-diethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aS,7R,7aS)-2,2-diethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 67888582 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (4aS,7R,7aS)-2,2-diethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
| SMILES | CCC1(CC)OC[C@@H]2OC[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C10H18O4/c1-3-10(4-2)13-6-8-9(14-10)7(11)5-12-8/h7-9,11H,3-6H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | YOICUKMEXCFJSQ-VGMNWLOBSA-N |
| XLogP | 0.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |