C12H19N — CID 67888872
trans-(1S,4R)-1,2,4-tris(ethenyl)cyclohexan-1-amine (PubChem CID 67888872) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is trans-(1S,4R)-1,2,4-tris(ethenyl)cyclohexan-1-amine.
| Compound Name | trans-(1S,4R)-1,2,4-tris(ethenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 67888872 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | trans-(1S,4R)-1,2,4-tris(ethenyl)cyclohexan-1-amine |
| SMILES | C=CC1C[C@H](C=C)CC[C@]1(N)C=C |
| InChI | InChI=1S/C12H19N/c1-4-10-7-8-12(13,6-3)11(5-2)9-10/h4-6,10-11H,1-3,7-9,13H2/t10-,11?,12-/m1/s1 |
| InChIKey | NZFSZLDMQXUIEL-IGBJHFKCSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|