C20H16N8O — CID 67888966
[5-(2,4,7,8,10-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,9,12,14-hexaen-8-yl)-1-phenyltriazol-4-yl]methanol (PubChem CID 67888966) has the molecular formula C20H16N8O and a molecular weight of 384.40 g/mol. Its IUPAC name is [5-(2,4,7,8,10-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,9,12,14-hexaen-8-yl)-1-phenyltriazol-4-yl]methanol.
| Compound Name | [5-(2,4,7,8,10-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,9,12,14-hexaen-8-yl)-1-phenyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 67888966 |
| Molecular Formula | C20H16N8O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [5-(2,4,7,8,10-pentazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,9,12,14-hexaen-8-yl)-1-phenyltriazol-4-yl]methanol |
| SMILES | OCc1nnn(-c2ccccc2)c1N1C=NC2c3ccccc3-n3cncc3N21 |
| InChI | InChI=1S/C20H16N8O/c29-11-16-20(27(24-23-16)14-6-2-1-3-7-14)26-13-22-19-15-8-4-5-9-17(15)25-12-21-10-18(25)28(19)26/h1-10,12-13,19,29H,11H2 |
| InChIKey | BZCSJNNNMXQWHP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |