About [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol
[4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol (PubChem CID 67889359) has the molecular formula C20H20N6O2
and a molecular weight of 376.42 g/mol. Its IUPAC name is [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 67889359 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol |
| SMILES | Nc1nc(N)c2cc(Cn3ccnc3)c(-c3ccc(CO)c(CO)c3)cc2n1 |
| InChI | InChI=1S/C20H20N6O2/c21-19-17-6-14(8-26-4-3-23-11-26)16(7-18(17)24-20(22)25-19)12-1-2-13(9-27)15(5-12)10-28/h1-7,11,27-28H,8-10H2,(H4,21,22,24,25) |
| InChIKey | KHXQSOCPVWGFGA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol?
The IUPAC name of [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol (CID 67889359) is [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol is Nc1nc(N)c2cc(Cn3ccnc3)c(-c3ccc(CO)c(CO)c3)cc2n1.
What is the InChIKey of [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol?
The InChIKey is KHXQSOCPVWGFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6O2/c21-19-17-6-14(8-26-4-3-23-11-26)16(7-18(17)24-20(22)25-19)12-1-2-13(9-27)15(5-12)10-28/h1-7,11,27-28H,8-10H2,(H4,21,22,24,25).
What are the key properties of [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol?
[4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol has a molecular weight of 376.42 g/mol, XLogP of 1.69, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,4-diamino-6-(imidazol-1-ylmethyl)quinazolin-7-yl]-2-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 67889359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).