C16H14N6 — CID 67889365
6-methyl-7-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinazoline-2,4-diamine (PubChem CID 67889365) has the molecular formula C16H14N6 and a molecular weight of 290.33 g/mol. Its IUPAC name is 6-methyl-7-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinazoline-2,4-diamine.
| Compound Name | 6-methyl-7-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 67889365 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-methyl-7-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinazoline-2,4-diamine |
| SMILES | Cc1cc2c(N)nc(N)nc2cc1-c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H14N6/c1-8-4-12-13(21-16(18)22-14(12)17)6-11(8)10-5-9-2-3-19-15(9)20-7-10/h2-7H,1H3,(H,19,20)(H4,17,18,21,22) |
| InChIKey | JTOMSJOIFXSANF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |