About 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate
1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate (PubChem CID 67890075) has the molecular formula C22H38O3
and a molecular weight of 350.54 g/mol. Its IUPAC name is 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
| PubChem CID | 67890075 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCC(OC(=O)C1CCC(C2CCC(O)CC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C22H38O3/c1-2-21(18-6-4-3-5-7-18)25-22(24)19-10-8-16(9-11-19)17-12-14-20(23)15-13-17/h16-21,23H,2-15H2,1H3 |
| InChIKey | GNNDNDMNBVCGMK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The IUPAC name of 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate (CID 67890075) is 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate.
What is the SMILES notation for 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The canonical SMILES for 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate is CCC(OC(=O)C1CCC(C2CCC(O)CC2)CC1)C1CCCCC1.
What is the InChIKey of 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
The InChIKey is GNNDNDMNBVCGMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O3/c1-2-21(18-6-4-3-5-7-18)25-22(24)19-10-8-16(9-11-19)17-12-14-20(23)15-13-17/h16-21,23H,2-15H2,1H3.
What are the key properties of 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate?
1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate has a molecular weight of 350.54 g/mol, XLogP of 5.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpropyl 4-(4-hydroxycyclohexyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 67890075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).