About tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate
tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate (PubChem CID 67890715) has the molecular formula C19H26N2O4S
and a molecular weight of 378.49 g/mol. Its IUPAC name is tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate |
| PubChem CID | 67890715 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate |
| SMILES | Cc1nn(Cc2ccc(S(C)(=O)=O)cc2)c(C)c1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N2O4S/c1-13-17(11-18(22)25-19(3,4)5)14(2)21(20-13)12-15-7-9-16(10-8-15)26(6,23)24/h7-10H,11-12H2,1-6H3 |
| InChIKey | GNDGRWCBWIMGOT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate?
The IUPAC name of tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate (CID 67890715) is tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate.
What is the SMILES notation for tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate?
The canonical SMILES for tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate is Cc1nn(Cc2ccc(S(C)(=O)=O)cc2)c(C)c1CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate?
The InChIKey is GNDGRWCBWIMGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4S/c1-13-17(11-18(22)25-19(3,4)5)14(2)21(20-13)12-15-7-9-16(10-8-15)26(6,23)24/h7-10H,11-12H2,1-6H3.
What are the key properties of tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate?
tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate has a molecular weight of 378.49 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[3,5-dimethyl-1-[(4-methylsulfonylphenyl)methyl]pyrazol-4-yl]acetate is sourced from PubChem (CID 67890715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).