C8H12F5NO2S — CID 67890803
1-(1,1,1,3,3-pentafluoropropan-2-ylsulfonyl)piperidine (PubChem CID 67890803) has the molecular formula C8H12F5NO2S and a molecular weight of 281.25 g/mol. Its IUPAC name is 1-(1,1,1,3,3-pentafluoropropan-2-ylsulfonyl)piperidine.
| Compound Name | 1-(1,1,1,3,3-pentafluoropropan-2-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 67890803 |
| Molecular Formula | C8H12F5NO2S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1-(1,1,1,3,3-pentafluoropropan-2-ylsulfonyl)piperidine |
| SMILES | O=S(=O)(C(C(F)F)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C8H12F5NO2S/c9-7(10)6(8(11,12)13)17(15,16)14-4-2-1-3-5-14/h6-7H,1-5H2 |
| InChIKey | WZJNNSNHODMZIB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |